C30H26N4O — CID 102450798
5-(4-methoxyphenyl)-10,15,20-trimethyl-21,22-dihydroporphyrin (PubChem CID 102450798) has the molecular formula C30H26N4O and a molecular weight of 458.57 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-10,15,20-trimethyl-21,22-dihydroporphyrin.
| Compound Name | 5-(4-methoxyphenyl)-10,15,20-trimethyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 102450798 |
| Molecular Formula | C30H26N4O |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 5-(4-methoxyphenyl)-10,15,20-trimethyl-21,22-dihydroporphyrin |
| SMILES | COc1ccc(-c2c3ccc([nH]3)c(C)c3nc(c(C)c4nc(c(C)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C30H26N4O/c1-17-22-9-11-24(31-22)18(2)26-13-15-28(33-26)30(20-5-7-21(35-4)8-6-20)29-16-14-27(34-29)19(3)25-12-10-23(17)32-25/h5-16,33-34H,1-4H3/b22-17-,23-17-,24-18-,25-19-,26-18-,27-19-,30-28-,30-29- |
| InChIKey | IOHOQUQELGMYSI-WLCYTWJVSA-N |
| XLogP | 7.26 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |