C50H42N4O6 — CID 11585878
10,15,20-tris(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-21,22-dihydroporphyrin (PubChem CID 11585878) has the molecular formula C50H42N4O6 and a molecular weight of 794.91 g/mol. Its IUPAC name is 10,15,20-tris(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-21,22-dihydroporphyrin.
| Compound Name | 10,15,20-tris(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11585878 |
| Molecular Formula | C50H42N4O6 |
| Molecular Weight | 794.91 g/mol |
| Exact Mass | 794.31 |
| IUPAC Name | 10,15,20-tris(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-21,22-dihydroporphyrin |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccc(OC)cc4)c4ccc([nH]4)c(-c4cc(OC)c(OC)c(OC)c4)c4ccc([nH]4)c(-c4ccc(OC)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C50H42N4O6/c1-55-33-13-7-29(8-14-33)46-36-19-21-38(51-36)47(30-9-15-34(56-2)16-10-30)40-23-25-42(53-40)49(32-27-44(58-4)50(60-6)45(28-32)59-5)43-26-24-41(54-43)48(39-22-20-37(46)52-39)31-11-17-35(57-3)18-12-31/h7-28,53-54H,1-6H3/b46-36-,46-37-,47-38-,47-40-,48-39-,48-41-,49-42-,49-43- |
| InChIKey | FHZLBHUNZOVULV-CTDUHSOGSA-N |
| XLogP | 11.38 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.91 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |