C58H52N6O6 — CID 137247156
4-[10,20-bis(4-butoxy-3,5-dimethoxyphenyl)-15-(4-cyanophenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile (PubChem CID 137247156) has the molecular formula C58H52N6O6 and a molecular weight of 929.09 g/mol. Its IUPAC name is 4-[10,20-bis(4-butoxy-3,5-dimethoxyphenyl)-15-(4-cyanophenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile.
| Compound Name | 4-[10,20-bis(4-butoxy-3,5-dimethoxyphenyl)-15-(4-cyanophenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 137247156 |
| Molecular Formula | C58H52N6O6 |
| Molecular Weight | 929.09 g/mol |
| Exact Mass | 928.39 |
| IUPAC Name | 4-[10,20-bis(4-butoxy-3,5-dimethoxyphenyl)-15-(4-cyanophenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile |
| SMILES | CCCCOc1c(OC)cc(-c2c3nc(c(-c4ccc(C#N)cc4)c4ccc([nH]4)c(-c4cc(OC)c(OCCCC)c(OC)c4)c4nc(c(-c5ccc(C#N)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1OC |
| InChI | InChI=1S/C58H52N6O6/c1-7-9-27-69-57-49(65-3)29-39(30-50(57)66-4)55-45-23-19-41(61-45)53(37-15-11-35(33-59)12-16-37)43-21-25-47(63-43)56(40-31-51(67-5)58(52(32-40)68-6)70-28-10-8-2)48-26-22-44(64-48)54(42-20-24-46(55)62-42)38-17-13-36(34-60)14-18-38/h11-26,29-32,61,64H,7-10,27-28H2,1-6H3/b53-41-,53-43-,54-42-,54-44-,55-45-,55-46-,56-47-,56-48- |
| InChIKey | YMALCWXHBGMHPT-JXQKWFQVSA-N |
| XLogP | 13.46 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.09 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|