C84H118N4O6 — CID 170907192
5,15-diethynyl-10,20-bis(3,4,5-trioctoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 170907192) has the molecular formula C84H118N4O6 and a molecular weight of 1279.89 g/mol. Its IUPAC name is 5,15-diethynyl-10,20-bis(3,4,5-trioctoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,15-diethynyl-10,20-bis(3,4,5-trioctoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 170907192 |
| Molecular Formula | C84H118N4O6 |
| Molecular Weight | 1279.89 g/mol |
| Exact Mass | 1278.91 |
| IUPAC Name | 5,15-diethynyl-10,20-bis(3,4,5-trioctoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | C#Cc1c2nc(c(-c3cc(OCCCCCCCC)c(OCCCCCCCC)c(OCCCCCCCC)c3)c3ccc([nH]3)c(C#C)c3nc(c(-c4cc(OCCCCCCCC)c(OCCCCCCCC)c(OCCCCCCCC)c4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C84H118N4O6/c1-9-17-23-29-35-41-55-89-77-61-65(62-78(90-56-42-36-30-24-18-10-2)83(77)93-59-45-39-33-27-21-13-5)81-73-51-47-69(85-73)67(15-7)71-49-53-75(87-71)82(76-54-50-72(88-76)68(16-8)70-48-52-74(81)86-70)66-63-79(91-57-43-37-31-25-19-11-3)84(94-60-46-40-34-28-22-14-6)80(64-66)92-58-44-38-32-26-20-12-4/h7-8,47-54,61-64,85,88H,9-14,17-46,55-60H2,1-6H3/b69-67-,70-68-,71-67-,72-68-,81-73-,81-74-,82-75-,82-76- |
| InChIKey | BYHXKAXCOMDIFT-TZLPNLLRSA-N |
| XLogP | 24.39 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1279.89 |
| LogP ≤ 5 | 24.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|