C92H126N4O4 — CID 136711243
5,10,15,20-tetrakis[4-hexoxy-3,5-di(propan-2-yl)phenyl]-21,23-dihydroporphyrin (PubChem CID 136711243) has the molecular formula C92H126N4O4 and a molecular weight of 1352.04 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[4-hexoxy-3,5-di(propan-2-yl)phenyl]-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[4-hexoxy-3,5-di(propan-2-yl)phenyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136711243 |
| Molecular Formula | C92H126N4O4 |
| Molecular Weight | 1352.04 g/mol |
| Exact Mass | 1350.98 |
| IUPAC Name | 5,10,15,20-tetrakis[4-hexoxy-3,5-di(propan-2-yl)phenyl]-21,23-dihydroporphyrin |
| SMILES | CCCCCCOc1c(C(C)C)cc(-c2c3nc(c(-c4cc(C(C)C)c(OCCCCCC)c(C(C)C)c4)c4ccc([nH]4)c(-c4cc(C(C)C)c(OCCCCCC)c(C(C)C)c4)c4nc(c(-c5cc(C(C)C)c(OCCCCCC)c(C(C)C)c5)c5ccc2[nH]5)C=C4)C=C3)cc1C(C)C |
| InChI | InChI=1S/C92H126N4O4/c1-21-25-29-33-45-97-89-69(57(5)6)49-65(50-70(89)58(7)8)85-77-37-39-79(93-77)86(66-51-71(59(9)10)90(72(52-66)60(11)12)98-46-34-30-26-22-2)81-41-43-83(95-81)88(68-55-75(63(17)18)92(76(56-68)64(19)20)100-48-36-32-28-24-4)84-44-42-82(96-84)87(80-40-38-78(85)94-80)67-53-73(61(13)14)91(74(54-67)62(15)16)99-47-35-31-27-23-3/h37-44,49-64,93,96H,21-36,45-48H2,1-20H3/b85-77-,85-78-,86-79-,86-81-,87-80-,87-82-,88-83-,88-84- |
| InChIKey | UIIGVHNKRDKYOQ-NBDQVFEOSA-N |
| XLogP | 28.15 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 100 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1352.04 |
| LogP ≤ 5 | 28.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|