C67H54N6O9 — CID 132513773
5-[4-[2-(1,10-phenanthrolin-5-yl)ethynyl]phenyl]-10,15,20-tris(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 132513773) has the molecular formula C67H54N6O9 and a molecular weight of 1087.20 g/mol. Its IUPAC name is 5-[4-[2-(1,10-phenanthrolin-5-yl)ethynyl]phenyl]-10,15,20-tris(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-[4-[2-(1,10-phenanthrolin-5-yl)ethynyl]phenyl]-10,15,20-tris(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 132513773 |
| Molecular Formula | C67H54N6O9 |
| Molecular Weight | 1087.20 g/mol |
| Exact Mass | 1086.40 |
| IUPAC Name | 5-[4-[2-(1,10-phenanthrolin-5-yl)ethynyl]phenyl]-10,15,20-tris(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1cc(-c2c3nc(c(-c4cc(OC)c(OC)c(OC)c4)c4ccc([nH]4)c(-c4cc(OC)c(OC)c(OC)c4)c4nc(c(-c5ccc(C#Cc6cc7cccnc7c7ncccc67)cc5)c5ccc2[nH]5)C=C4)C=C3)cc(OC)c1OC |
| InChI | InChI=1S/C67H54N6O9/c1-74-53-31-41(32-54(75-2)65(53)80-7)60-47-22-20-45(70-47)59(38-17-14-37(15-18-38)16-19-39-30-40-12-10-28-68-63(40)64-44(39)13-11-29-69-64)46-21-23-48(71-46)61(42-33-55(76-3)66(81-8)56(34-42)77-4)50-25-27-52(73-50)62(51-26-24-49(60)72-51)43-35-57(78-5)67(82-9)58(36-43)79-6/h10-15,17-18,20-36,70,73H,1-9H3/b59-45-,59-46-,60-47-,60-49-,61-48-,61-50-,62-51-,62-52- |
| InChIKey | QHXUAKXTBDIQHK-WBXAWAKJSA-N |
| XLogP | 13.90 |
| TPSA | 166.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.20 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|