C54H38N4O2 — CID 135443520
5-(9,10-dimethoxyphenanthren-1-yl)-10,15,20-triphenyl-21,23-dihydroporphyrin (PubChem CID 135443520) has the molecular formula C54H38N4O2 and a molecular weight of 774.92 g/mol. Its IUPAC name is 5-(9,10-dimethoxyphenanthren-1-yl)-10,15,20-triphenyl-21,23-dihydroporphyrin.
| Compound Name | 5-(9,10-dimethoxyphenanthren-1-yl)-10,15,20-triphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135443520 |
| Molecular Formula | C54H38N4O2 |
| Molecular Weight | 774.92 g/mol |
| Exact Mass | 774.30 |
| IUPAC Name | 5-(9,10-dimethoxyphenanthren-1-yl)-10,15,20-triphenyl-21,23-dihydroporphyrin |
| SMILES | COc1c(OC)c2c(-c3c4nc(c(-c5ccccc5)c5ccc([nH]5)c(-c5ccccc5)c5nc(c(-c6ccccc6)c6ccc3[nH]6)C=C5)C=C4)cccc2c2ccccc12 |
| InChI | InChI=1S/C54H38N4O2/c1-59-53-38-22-13-12-21-36(38)37-23-14-24-39(51(37)54(53)60-2)52-46-31-29-44(57-46)49(34-17-8-4-9-18-34)42-27-25-40(55-42)48(33-15-6-3-7-16-33)41-26-28-43(56-41)50(35-19-10-5-11-20-35)45-30-32-47(52)58-45/h3-32,55,58H,1-2H3/b48-40-,48-41-,49-42-,49-44-,50-43-,50-45-,52-46-,52-47- |
| InChIKey | GEFCALDEFBEYDD-MXZXBRIKSA-N |
| XLogP | 13.65 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.92 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|