C48H38FeN4O4 — CID 175061750
iron;5,10,15,20-tetrakis(2-methoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 175061750) has the molecular formula C48H38FeN4O4 and a molecular weight of 790.70 g/mol. Its IUPAC name is iron;5,10,15,20-tetrakis(2-methoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | iron;5,10,15,20-tetrakis(2-methoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 175061750 |
| Molecular Formula | C48H38FeN4O4 |
| Molecular Weight | 790.70 g/mol |
| Exact Mass | 790.22 |
| IUPAC Name | iron;5,10,15,20-tetrakis(2-methoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1ccccc1-c1c2nc(c(-c3ccccc3OC)c3ccc([nH]3)c(-c3ccccc3OC)c3nc(c(-c4ccccc4OC)c4ccc1[nH]4)C=C3)C=C2.[Fe] |
| InChI | InChI=1S/C48H38N4O4.Fe/c1-53-41-17-9-5-13-29(41)45-33-21-23-35(49-33)46(30-14-6-10-18-42(30)54-2)37-25-27-39(51-37)48(32-16-8-12-20-44(32)56-4)40-28-26-38(52-40)47(36-24-22-34(45)50-36)31-15-7-11-19-43(31)55-3;/h5-28,49,52H,1-4H3;/b45-33-,45-34-,46-35-,46-37-,47-36-,47-38-,48-39-,48-40-; |
| InChIKey | DUIBCUPFIGOJRI-LPXWNWKISA-N |
| XLogP | 11.36 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.70 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|