C48H42N8 — CID 135409013
[2-[10,15,20-tris[2-(aminomethyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]methanamine (PubChem CID 135409013) has the molecular formula C48H42N8 and a molecular weight of 730.92 g/mol. Its IUPAC name is [2-[10,15,20-tris[2-(aminomethyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]methanamine.
| Compound Name | [2-[10,15,20-tris[2-(aminomethyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 135409013 |
| Molecular Formula | C48H42N8 |
| Molecular Weight | 730.92 g/mol |
| Exact Mass | 730.35 |
| IUPAC Name | [2-[10,15,20-tris[2-(aminomethyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]methanamine |
| SMILES | NCc1ccccc1-c1c2nc(c(-c3ccccc3CN)c3ccc([nH]3)c(-c3ccccc3CN)c3nc(c(-c4ccccc4CN)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C48H42N8/c49-25-29-9-1-5-13-33(29)45-37-17-19-39(53-37)46(34-14-6-2-10-30(34)26-50)41-21-23-43(55-41)48(36-16-8-4-12-32(36)28-52)44-24-22-42(56-44)47(40-20-18-38(45)54-40)35-15-7-3-11-31(35)27-51/h1-24,53,56H,25-28,49-52H2/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44- |
| InChIKey | PVCWQURBGYAGRF-PJEPRTEXSA-N |
| XLogP | 9.16 |
| TPSA | 161.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.92 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |