C52H38N4 — CID 136954903
5,10,15,20-tetrakis(2-ethenylphenyl)-21,23-dihydroporphyrin (PubChem CID 136954903) has the molecular formula C52H38N4 and a molecular weight of 718.90 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2-ethenylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2-ethenylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136954903 |
| Molecular Formula | C52H38N4 |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | 5,10,15,20-tetrakis(2-ethenylphenyl)-21,23-dihydroporphyrin |
| SMILES | C=Cc1ccccc1-c1c2nc(c(-c3ccccc3C=C)c3ccc([nH]3)c(-c3ccccc3C=C)c3nc(c(-c4ccccc4C=C)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C52H38N4/c1-5-33-17-9-13-21-37(33)49-41-25-27-43(53-41)50(38-22-14-10-18-34(38)6-2)45-29-31-47(55-45)52(40-24-16-12-20-36(40)8-4)48-32-30-46(56-48)51(44-28-26-42(49)54-44)39-23-15-11-19-35(39)7-3/h5-32,53,56H,1-4H2/b49-41-,49-42-,50-43-,50-45-,51-44-,51-46-,52-47-,52-48- |
| InChIKey | OIBCAMKOOSNYON-RCOMQYLTSA-N |
| XLogP | 13.90 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |