C48H30N4O8Ti — CID 157132426
titanium;2-[10,15,20-tris(2-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 157132426) has the molecular formula C48H30N4O8Ti and a molecular weight of 838.66 g/mol. Its IUPAC name is titanium;2-[10,15,20-tris(2-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | titanium;2-[10,15,20-tris(2-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 157132426 |
| Molecular Formula | C48H30N4O8Ti |
| Molecular Weight | 838.66 g/mol |
| Exact Mass | 838.15 |
| IUPAC Name | titanium;2-[10,15,20-tris(2-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2nc(c(-c3ccccc3C(=O)O)c3ccc([nH]3)c(-c3ccccc3C(=O)O)c3nc(c(-c4ccccc4C(=O)O)c4ccc1[nH]4)C=C3)C=C2.[Ti] |
| InChI | InChI=1S/C48H30N4O8.Ti/c53-45(54)29-13-5-1-9-25(29)41-33-17-19-35(49-33)42(26-10-2-6-14-30(26)46(55)56)37-21-23-39(51-37)44(28-12-4-8-16-32(28)48(59)60)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-11-3-7-15-31(27)47(57)58;/h1-24,49,52H,(H,53,54)(H,55,56)(H,57,58)(H,59,60);/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | AJFNZGVJIDLVDO-DAJBKUBHSA-N |
| XLogP | 10.11 |
| TPSA | 206.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.66 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |