C52H30N4O16 — CID 87763868
2-[10,15,20-tris(2,6-dicarboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzene-1,3-dicarboxylic acid (PubChem CID 87763868) has the molecular formula C52H30N4O16 and a molecular weight of 966.82 g/mol. Its IUPAC name is 2-[10,15,20-tris(2,6-dicarboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 2-[10,15,20-tris(2,6-dicarboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 87763868 |
| Molecular Formula | C52H30N4O16 |
| Molecular Weight | 966.82 g/mol |
| Exact Mass | 966.17 |
| IUPAC Name | 2-[10,15,20-tris(2,6-dicarboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cccc(C(=O)O)c1-c1c2nc(c(-c3c(C(=O)O)cccc3C(=O)O)c3ccc([nH]3)c(-c3c(C(=O)O)cccc3C(=O)O)c3nc(c(-c4c(C(=O)O)cccc4C(=O)O)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C52H30N4O16/c57-45(58)21-5-1-6-22(46(59)60)37(21)41-29-13-15-31(53-29)42(38-23(47(61)62)7-2-8-24(38)48(63)64)33-17-19-35(55-33)44(40-27(51(69)70)11-4-12-28(40)52(71)72)36-20-18-34(56-36)43(32-16-14-30(41)54-32)39-25(49(65)66)9-3-10-26(39)50(67)68/h1-20,53,56H,(H,57,58)(H,59,60)(H,61,62)(H,63,64)(H,65,66)(H,67,68)(H,69,70)(H,71,72)/b41-29+,41-30+,42-31+,42-33+,43-32+,43-34+,44-35+,44-36+ |
| InChIKey | JHOWODDQSARORH-DSIMAETFSA-N |
| XLogP | 8.91 |
| TPSA | 355.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.82 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |