C40H22N4O12 — CID 135697201
2-[10,15,20-tris(3-carboxyfuran-2-yl)-21,23-dihydroporphyrin-5-yl]furan-3-carboxylic acid (PubChem CID 135697201) has the molecular formula C40H22N4O12 and a molecular weight of 750.63 g/mol. Its IUPAC name is 2-[10,15,20-tris(3-carboxyfuran-2-yl)-21,23-dihydroporphyrin-5-yl]furan-3-carboxylic acid.
| Compound Name | 2-[10,15,20-tris(3-carboxyfuran-2-yl)-21,23-dihydroporphyrin-5-yl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 135697201 |
| Molecular Formula | C40H22N4O12 |
| Molecular Weight | 750.63 g/mol |
| Exact Mass | 750.12 |
| IUPAC Name | 2-[10,15,20-tris(3-carboxyfuran-2-yl)-21,23-dihydroporphyrin-5-yl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1-c1c2nc(c(-c3occc3C(=O)O)c3ccc([nH]3)c(-c3occc3C(=O)O)c3nc(c(-c4occc4C(=O)O)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C40H22N4O12/c45-37(46)17-9-13-53-33(17)29-21-1-2-22(41-21)30(34-18(38(47)48)10-14-54-34)24-5-6-26(43-24)32(36-20(40(51)52)12-16-56-36)28-8-7-27(44-28)31(25-4-3-23(29)42-25)35-19(39(49)50)11-15-55-35/h1-16,41,44H,(H,45,46)(H,47,48)(H,49,50)(H,51,52)/b29-21+,29-23+,30-22+,30-24+,31-25+,31-27+,32-26+,32-28+ |
| InChIKey | GLOLKEZDVVTMQY-ZSMLRSKPSA-N |
| XLogP | 8.49 |
| TPSA | 259.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.63 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |