C14H11NO3 — CID 82387630
2-(7-methyl-1H-indol-2-yl)furan-3-carboxylic acid (PubChem CID 82387630) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-(7-methyl-1H-indol-2-yl)furan-3-carboxylic acid.
| Compound Name | 2-(7-methyl-1H-indol-2-yl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 82387630 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-(7-methyl-1H-indol-2-yl)furan-3-carboxylic acid |
| SMILES | Cc1cccc2cc(-c3occc3C(=O)O)[nH]c12 |
| InChI | InChI=1S/C14H11NO3/c1-8-3-2-4-9-7-11(15-12(8)9)13-10(14(16)17)5-6-18-13/h2-7,15H,1H3,(H,16,17) |
| InChIKey | SPFAPRHLRPUSIZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |