C51H15F19N4O2S — CID 136711145
4-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]sulfanylbenzoic acid (PubChem CID 136711145) has the molecular formula C51H15F19N4O2S and a molecular weight of 1108.74 g/mol. Its IUPAC name is 4-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]sulfanylbenzoic acid.
| Compound Name | 4-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 136711145 |
| Molecular Formula | C51H15F19N4O2S |
| Molecular Weight | 1108.74 g/mol |
| Exact Mass | 1108.06 |
| IUPAC Name | 4-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]sulfanylbenzoic acid |
| SMILES | O=C(O)c1ccc(Sc2c(F)c(F)c(-c3c4nc(c(-c5c(F)c(F)c(F)c(F)c5F)c5ccc([nH]5)c(-c5c(F)c(F)c(F)c(F)c5F)c5nc(c(-c6c(F)c(F)c(F)c(F)c6F)c6ccc3[nH]6)C=C5)C=C4)c(F)c2F)cc1 |
| InChI | InChI=1S/C51H15F19N4O2S/c52-31-27(32(53)40(61)45(66)39(31)60)23-15-5-7-17(71-15)24(28-33(54)41(62)46(67)42(63)34(28)55)19-9-11-21(73-19)26(30-37(58)48(69)50(49(70)38(30)59)77-14-3-1-13(2-4-14)51(75)76)22-12-10-20(74-22)25(18-8-6-16(23)72-18)29-35(56)43(64)47(68)44(65)36(29)57/h1-12,71,74H,(H,75,76)/b23-15+,23-16+,24-17+,24-19+,25-18+,25-20+,26-21+,26-22+ |
| InChIKey | MSJLDAZEDFCLKG-MDJQRXALSA-N |
| XLogP | 15.82 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.74 |
| LogP ≤ 5 | 15.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|