C46H16F19N5S — CID 137272876
2-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]sulfanylethanamine (PubChem CID 137272876) has the molecular formula C46H16F19N5S and a molecular weight of 1031.70 g/mol. Its IUPAC name is 2-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]sulfanylethanamine.
| Compound Name | 2-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]sulfanylethanamine |
|---|---|
| PubChem CID | 137272876 |
| Molecular Formula | C46H16F19N5S |
| Molecular Weight | 1031.70 g/mol |
| Exact Mass | 1031.08 |
| IUPAC Name | 2-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]sulfanylethanamine |
| SMILES | NCCSc1c(F)c(F)c(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4nc(c(-c5c(F)c(F)c(F)c(F)c5F)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C46H16F19N5S/c47-27-23(28(48)36(56)41(61)35(27)55)19-11-1-3-13(67-11)20(24-29(49)37(57)42(62)38(58)30(24)50)15-5-7-17(69-15)22(26-33(53)44(64)46(71-10-9-66)45(65)34(26)54)18-8-6-16(70-18)21(14-4-2-12(19)68-14)25-31(51)39(59)43(63)40(60)32(25)52/h1-8,67,70H,9-10,66H2/b19-11+,19-12+,20-13+,20-15+,21-14+,21-16+,22-17+,22-18+ |
| InChIKey | WXGVHALMJOHMOE-ZPVLRGSYSA-N |
| XLogP | 14.02 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.70 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|