C38H10F24N4 — CID 15282346
5,15-bis(1,1,2,2,3,3,3-heptafluoropropyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin (PubChem CID 15282346) has the molecular formula C38H10F24N4 and a molecular weight of 978.48 g/mol. Its IUPAC name is 5,15-bis(1,1,2,2,3,3,3-heptafluoropropyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin.
| Compound Name | 5,15-bis(1,1,2,2,3,3,3-heptafluoropropyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 15282346 |
| Molecular Formula | C38H10F24N4 |
| Molecular Weight | 978.48 g/mol |
| Exact Mass | 978.05 |
| IUPAC Name | 5,15-bis(1,1,2,2,3,3,3-heptafluoropropyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin |
| SMILES | Fc1c(F)c(F)c(-c2c3nc(c(C(F)(F)C(F)(F)C(F)(F)F)c4nc(c(-c5c(F)c(F)c(F)c(F)c5F)c5ccc([nH]5)c(C(F)(F)C(F)(F)C(F)(F)F)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C38H10F24N4/c39-23-19(24(40)28(44)31(47)27(23)43)17-9-1-5-13(63-9)21(33(49,50)35(53,54)37(57,58)59)14-7-3-11(65-14)18(20-25(41)29(45)32(48)30(46)26(20)42)12-4-8-16(66-12)22(15-6-2-10(17)64-15)34(51,52)36(55,56)38(60,61)62/h1-8,63,65H/b17-9+,17-10+,18-11+,18-12+,21-13+,21-14+,22-15+,22-16+ |
| InChIKey | GOFQWECRAQSXMO-ANJVIYKFSA-N |
| XLogP | 13.96 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.48 |
| LogP ≤ 5 | 13.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|