C32H10F28N4Pt — CID 161320346
platinum;5,10,15,20-tetrakis(1,1,2,2,3,3,3-heptafluoropropyl)-21,22-dihydroporphyrin (PubChem CID 161320346) has the molecular formula C32H10F28N4Pt and a molecular weight of 1177.48 g/mol. Its IUPAC name is platinum;5,10,15,20-tetrakis(1,1,2,2,3,3,3-heptafluoropropyl)-21,22-dihydroporphyrin.
| Compound Name | platinum;5,10,15,20-tetrakis(1,1,2,2,3,3,3-heptafluoropropyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 161320346 |
| Molecular Formula | C32H10F28N4Pt |
| Molecular Weight | 1177.48 g/mol |
| Exact Mass | 1177.01 |
| IUPAC Name | platinum;5,10,15,20-tetrakis(1,1,2,2,3,3,3-heptafluoropropyl)-21,22-dihydroporphyrin |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1c2nc(c(C(F)(F)C(F)(F)C(F)(F)F)c3ccc([nH]3)c(C(F)(F)C(F)(F)C(F)(F)F)c3ccc([nH]3)c(C(F)(F)C(F)(F)C(F)(F)F)c3nc1C=C3)C=C2.[Pt] |
| InChI | InChI=1S/C32H10F28N4.Pt/c33-21(34,25(41,42)29(49,50)51)17-9-1-2-10(61-9)18(22(35,36)26(43,44)30(52,53)54)12-5-6-14(63-12)20(24(39,40)28(47,48)32(58,59)60)16-8-7-15(64-16)19(13-4-3-11(17)62-13)23(37,38)27(45,46)31(55,56)57;/h1-8,61-62H;/b17-9+,17-11+,18-10+,18-12+,19-13+,19-15+,20-14+,20-16+; |
| InChIKey | BLBYYBNMMRLXEJ-HQJDZOCDSA-N |
| XLogP | 13.81 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1177.48 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|