C24H10F12N4 — CID 10099782
5,10,15,20-tetrakis(trifluoromethyl)-21,22-dihydroporphyrin (PubChem CID 10099782) has the molecular formula C24H10F12N4 and a molecular weight of 582.35 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(trifluoromethyl)-21,22-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(trifluoromethyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10099782 |
| Molecular Formula | C24H10F12N4 |
| Molecular Weight | 582.35 g/mol |
| Exact Mass | 582.07 |
| IUPAC Name | 5,10,15,20-tetrakis(trifluoromethyl)-21,22-dihydroporphyrin |
| SMILES | FC(F)(F)c1c2nc(c(C(F)(F)F)c3ccc([nH]3)c(C(F)(F)F)c3ccc([nH]3)c(C(F)(F)F)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C24H10F12N4/c25-21(26,27)17-9-1-2-10(37-9)18(22(28,29)30)12-5-6-14(39-12)20(24(34,35)36)16-8-7-15(40-16)19(23(31,32)33)13-4-3-11(17)38-13/h1-8,37-38H/b17-9+,17-11+,18-10+,18-12+,19-13+,19-15+,20-14+,20-16+ |
| InChIKey | VIUYILPFSAJCRY-OTHQCIQNSA-N |
| XLogP | 8.73 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.35 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |