C28H20F6N4O4 — CID 11850721
diethyl 10,15-bis(trifluoromethyl)-22,24-dihydroporphyrin-2,3-dicarboxylate (PubChem CID 11850721) has the molecular formula C28H20F6N4O4 and a molecular weight of 590.48 g/mol. Its IUPAC name is diethyl 10,15-bis(trifluoromethyl)-22,24-dihydroporphyrin-2,3-dicarboxylate.
| Compound Name | diethyl 10,15-bis(trifluoromethyl)-22,24-dihydroporphyrin-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11850721 |
| Molecular Formula | C28H20F6N4O4 |
| Molecular Weight | 590.48 g/mol |
| Exact Mass | 590.14 |
| IUPAC Name | diethyl 10,15-bis(trifluoromethyl)-22,24-dihydroporphyrin-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)c2cc3ccc([nH]3)c(C(F)(F)F)c3nc(c(C(F)(F)F)c4ccc(cc1n2)[nH]4)C=C3 |
| InChI | InChI=1S/C28H20F6N4O4/c1-3-41-25(39)21-19-11-13-5-7-15(35-13)23(27(29,30)31)17-9-10-18(37-17)24(28(32,33)34)16-8-6-14(36-16)12-20(38-19)22(21)26(40)42-4-2/h5-12,35-36H,3-4H2,1-2H3/b13-11-,14-12-,19-11-,20-12-,23-15+,23-17+,24-16+,24-18+ |
| InChIKey | YYRNAEPWSMWNPG-GTWBYUABSA-N |
| XLogP | 6.56 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.48 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |