C44H42N4O6 — CID 135451095
ethyl 4-[4-[15-[4-(4-ethoxy-4-oxobutoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]butanoate (PubChem CID 135451095) has the molecular formula C44H42N4O6 and a molecular weight of 722.84 g/mol. Its IUPAC name is ethyl 4-[4-[15-[4-(4-ethoxy-4-oxobutoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]butanoate.
| Compound Name | ethyl 4-[4-[15-[4-(4-ethoxy-4-oxobutoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]butanoate |
|---|---|
| PubChem CID | 135451095 |
| Molecular Formula | C44H42N4O6 |
| Molecular Weight | 722.84 g/mol |
| Exact Mass | 722.31 |
| IUPAC Name | ethyl 4-[4-[15-[4-(4-ethoxy-4-oxobutoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4ccc(OCCCC(=O)OCC)cc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H42N4O6/c1-3-51-41(49)7-5-25-53-35-17-9-29(10-18-35)43-37-21-13-31(45-37)27-33-15-23-39(47-33)44(40-24-16-34(48-40)28-32-14-22-38(43)46-32)30-11-19-36(20-12-30)54-26-6-8-42(50)52-4-2/h9-24,27-28,45,48H,3-8,25-26H2,1-2H3/b31-27-,32-28-,33-27-,34-28-,43-37-,43-38-,44-39-,44-40- |
| InChIKey | VHWSLEOTYGLRDA-VBIFOYGBSA-N |
| XLogP | 9.43 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.84 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|