C62H46N4O3 — CID 137254251
ethyl 4-[4-(10,15,20-trinaphthalen-1-yl-21,23-dihydroporphyrin-5-yl)phenoxy]butanoate (PubChem CID 137254251) has the molecular formula C62H46N4O3 and a molecular weight of 895.08 g/mol. Its IUPAC name is ethyl 4-[4-(10,15,20-trinaphthalen-1-yl-21,23-dihydroporphyrin-5-yl)phenoxy]butanoate.
| Compound Name | ethyl 4-[4-(10,15,20-trinaphthalen-1-yl-21,23-dihydroporphyrin-5-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 137254251 |
| Molecular Formula | C62H46N4O3 |
| Molecular Weight | 895.08 g/mol |
| Exact Mass | 894.36 |
| IUPAC Name | ethyl 4-[4-(10,15,20-trinaphthalen-1-yl-21,23-dihydroporphyrin-5-yl)phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(-c2c3nc(c(-c4cccc5ccccc45)c4ccc([nH]4)c(-c4cccc5ccccc45)c4nc(c(-c5cccc6ccccc56)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C62H46N4O3/c1-2-68-58(67)25-12-38-69-43-28-26-42(27-29-43)59-50-30-32-52(63-50)60(47-22-9-16-39-13-3-6-19-44(39)47)54-34-36-56(65-54)62(49-24-11-18-41-15-5-8-21-46(41)49)57-37-35-55(66-57)61(53-33-31-51(59)64-53)48-23-10-17-40-14-4-7-20-45(40)48/h3-11,13-24,26-37,63,66H,2,12,25,38H2,1H3/b59-50-,59-51-,60-52-,60-54-,61-53-,61-55-,62-56-,62-57- |
| InChIKey | MMOCBNZWQNTJDW-FQORXOEESA-N |
| XLogP | 15.51 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.08 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|