C42H38N4O4 — CID 102393326
ethyl 3-[15-(3-ethoxy-3-oxopropyl)-10,20-diphenyl-21,22-dihydroporphyrin-5-yl]propanoate (PubChem CID 102393326) has the molecular formula C42H38N4O4 and a molecular weight of 662.79 g/mol. Its IUPAC name is ethyl 3-[15-(3-ethoxy-3-oxopropyl)-10,20-diphenyl-21,22-dihydroporphyrin-5-yl]propanoate.
| Compound Name | ethyl 3-[15-(3-ethoxy-3-oxopropyl)-10,20-diphenyl-21,22-dihydroporphyrin-5-yl]propanoate |
|---|---|
| PubChem CID | 102393326 |
| Molecular Formula | C42H38N4O4 |
| Molecular Weight | 662.79 g/mol |
| Exact Mass | 662.29 |
| IUPAC Name | ethyl 3-[15-(3-ethoxy-3-oxopropyl)-10,20-diphenyl-21,22-dihydroporphyrin-5-yl]propanoate |
| SMILES | CCOC(=O)CCc1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(CCC(=O)OCC)c3ccc([nH]3)c(-c3ccccc3)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C42H38N4O4/c1-3-49-39(47)25-15-29-31-17-21-35(43-31)41(27-11-7-5-8-12-27)37-23-19-33(45-37)30(16-26-40(48)50-4-2)34-20-24-38(46-34)42(28-13-9-6-10-14-28)36-22-18-32(29)44-36/h5-14,17-24,43-44H,3-4,15-16,25-26H2,1-2H3/b31-29-,32-29-,33-30-,34-30-,41-35-,41-37-,42-36-,42-38- |
| InChIKey | KMTJMIYSSIDUNE-KVJQTXRJSA-N |
| XLogP | 8.98 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.79 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |