C45H34N4O3 — CID 135858953
ethyl (2E,4E)-3-hydroxy-5-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)penta-2,4-dienoate (PubChem CID 135858953) has the molecular formula C45H34N4O3 and a molecular weight of 678.79 g/mol. Its IUPAC name is ethyl (2E,4E)-3-hydroxy-5-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-3-hydroxy-5-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 135858953 |
| Molecular Formula | C45H34N4O3 |
| Molecular Weight | 678.79 g/mol |
| Exact Mass | 678.26 |
| IUPAC Name | ethyl (2E,4E)-3-hydroxy-5-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(O)\C=C\c1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C45H34N4O3/c1-2-52-42(51)28-32(50)18-19-33-34-20-22-36(46-34)43(29-12-6-3-7-13-29)38-24-26-40(48-38)45(31-16-10-5-11-17-31)41-27-25-39(49-41)44(30-14-8-4-9-15-30)37-23-21-35(33)47-37/h3-28,46,49-50H,2H2,1H3/b19-18+,32-28+,34-33-,35-33-,43-36-,43-38-,44-37-,44-39-,45-40-,45-41- |
| InChIKey | FRWRFPMTIKMJCK-LUNGNMBOSA-N |
| XLogP | 10.67 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.79 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|