C56H62N4O4 — CID 135424755
methyl (E)-3-[10,20-bis(3,5-ditert-butylphenyl)-15-[(E)-3-methoxy-3-oxoprop-1-enyl]-21,23-dihydroporphyrin-5-yl]prop-2-enoate (PubChem CID 135424755) has the molecular formula C56H62N4O4 and a molecular weight of 855.14 g/mol. Its IUPAC name is methyl (E)-3-[10,20-bis(3,5-ditert-butylphenyl)-15-[(E)-3-methoxy-3-oxoprop-1-enyl]-21,23-dihydroporphyrin-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[10,20-bis(3,5-ditert-butylphenyl)-15-[(E)-3-methoxy-3-oxoprop-1-enyl]-21,23-dihydroporphyrin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 135424755 |
| Molecular Formula | C56H62N4O4 |
| Molecular Weight | 855.14 g/mol |
| Exact Mass | 854.48 |
| IUPAC Name | methyl (E)-3-[10,20-bis(3,5-ditert-butylphenyl)-15-[(E)-3-methoxy-3-oxoprop-1-enyl]-21,23-dihydroporphyrin-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1c2nc(c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccc([nH]3)c(/C=C/C(=O)OC)c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C56H62N4O4/c1-53(2,3)35-27-33(28-36(31-35)54(4,5)6)51-45-21-17-41(57-45)39(15-25-49(61)63-13)43-19-23-47(59-43)52(34-29-37(55(7,8)9)32-38(30-34)56(10,11)12)48-24-20-44(60-48)40(16-26-50(62)64-14)42-18-22-46(51)58-42/h15-32,57,60H,1-14H3/b25-15+,26-16+,41-39-,42-40-,43-39-,44-40-,51-45-,51-46-,52-47-,52-48- |
| InChIKey | NDJLRRLFFBIOHU-PMXGNZDGSA-N |
| XLogP | 13.55 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.14 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|