C64H66N4 — CID 135399612
5,15-bis(3,5-ditert-butylphenyl)-10,20-bis[(E)-2-phenylethenyl]-21,23-dihydroporphyrin (PubChem CID 135399612) has the molecular formula C64H66N4 and a molecular weight of 891.26 g/mol. Its IUPAC name is 5,15-bis(3,5-ditert-butylphenyl)-10,20-bis[(E)-2-phenylethenyl]-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(3,5-ditert-butylphenyl)-10,20-bis[(E)-2-phenylethenyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135399612 |
| Molecular Formula | C64H66N4 |
| Molecular Weight | 891.26 g/mol |
| Exact Mass | 890.53 |
| IUPAC Name | 5,15-bis(3,5-ditert-butylphenyl)-10,20-bis[(E)-2-phenylethenyl]-21,23-dihydroporphyrin |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(/C=C/c4ccccc4)c4ccc([nH]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(/C=C/c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C64H66N4/c1-61(2,3)45-35-43(36-46(39-45)62(4,5)6)59-55-31-27-51(65-55)49(25-23-41-19-15-13-16-20-41)53-29-33-57(67-53)60(44-37-47(63(7,8)9)40-48(38-44)64(10,11)12)58-34-30-54(68-58)50(52-28-32-56(59)66-52)26-24-42-21-17-14-18-22-42/h13-40,65,68H,1-12H3/b25-23+,26-24+,51-49-,52-50-,53-49-,54-50-,59-55-,59-56-,60-57-,60-58- |
| InChIKey | BTNYNAFQMBIRSL-ASOGDHACSA-N |
| XLogP | 17.52 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.26 |
| LogP ≤ 5 | 17.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |