C70H79N4- — CID 136802568
5,10,15-tris(3,5-ditert-butylphenyl)-20-(4-ethenylphenyl)-21,23-dihydroporphyrin (PubChem CID 136802568) has the molecular formula C70H79N4- and a molecular weight of 976.43 g/mol. Its IUPAC name is 5,10,15-tris(3,5-ditert-butylphenyl)-20-(4-ethenylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris(3,5-ditert-butylphenyl)-20-(4-ethenylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136802568 |
| Molecular Formula | C70H79N4- |
| Molecular Weight | 976.43 g/mol |
| Exact Mass | 975.63 |
| IUPAC Name | 5,10,15-tris(3,5-ditert-butylphenyl)-20-(4-ethenylphenyl)-21,23-dihydroporphyrin |
| SMILES | [H]/[C-]=C/c1ccc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc([nH]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C70H79N4/c1-20-42-21-23-43(24-22-42)61-53-25-27-55(71-53)62(44-33-47(65(2,3)4)39-48(34-44)66(5,6)7)57-29-31-59(73-57)64(46-37-51(69(14,15)16)41-52(38-46)70(17,18)19)60-32-30-58(74-60)63(56-28-26-54(61)72-56)45-35-49(67(8,9)10)40-50(36-45)68(11,12)13/h1,20-41,71,74H,2-19H3/q-1/b61-53-,61-54-,62-55-,62-57-,63-56-,63-58-,64-59-,64-60- |
| InChIKey | HBPCFEVOADTKTL-WJVFOVLXSA-N |
| XLogP | 19.55 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.43 |
| LogP ≤ 5 | 19.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|