C40H27IN4 — CID 136863679
5-[(E)-2-iodoethenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin (PubChem CID 136863679) has the molecular formula C40H27IN4 and a molecular weight of 690.59 g/mol. Its IUPAC name is 5-[(E)-2-iodoethenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin.
| Compound Name | 5-[(E)-2-iodoethenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136863679 |
| Molecular Formula | C40H27IN4 |
| Molecular Weight | 690.59 g/mol |
| Exact Mass | 690.13 |
| IUPAC Name | 5-[(E)-2-iodoethenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
| SMILES | I/C=C/c1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C40H27IN4/c41-25-24-29-30-16-18-32(42-30)38(26-10-4-1-5-11-26)34-20-22-36(44-34)40(28-14-8-3-9-15-28)37-23-21-35(45-37)39(27-12-6-2-7-13-27)33-19-17-31(29)43-33/h1-25,42,45H/b25-24+,30-29-,31-29-,38-32-,38-34-,39-33-,39-35-,40-36-,40-37- |
| InChIKey | YQYARTWHMHRJBY-DALPJMBKSA-N |
| XLogP | 11.06 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.59 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|