C75H91N5OS — CID 136693201
7-sulfanyl-N-[4-[10,15,20-tris(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]heptanamide (PubChem CID 136693201) has the molecular formula C75H91N5OS and a molecular weight of 1110.65 g/mol. Its IUPAC name is 7-sulfanyl-N-[4-[10,15,20-tris(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]heptanamide.
| Compound Name | 7-sulfanyl-N-[4-[10,15,20-tris(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]heptanamide |
|---|---|
| PubChem CID | 136693201 |
| Molecular Formula | C75H91N5OS |
| Molecular Weight | 1110.65 g/mol |
| Exact Mass | 1109.69 |
| IUPAC Name | 7-sulfanyl-N-[4-[10,15,20-tris(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]heptanamide |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc([nH]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(-c5ccc(NC(=O)CCCCCCS)cc5)c5ccc2[nH]5)C=C4)C=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C75H91N5OS/c1-70(2,3)50-37-47(38-51(43-50)71(4,5)6)67-59-30-28-57(77-59)66(46-24-26-56(27-25-46)76-65(81)23-21-19-20-22-36-82)58-29-31-60(78-58)68(48-39-52(72(7,8)9)44-53(40-48)73(10,11)12)62-33-35-64(80-62)69(63-34-32-61(67)79-63)49-41-54(74(13,14)15)45-55(42-49)75(16,17)18/h24-35,37-45,77,80,82H,19-23,36H2,1-18H3,(H,76,81)/b66-57-,66-58-,67-59-,67-61-,68-60-,68-62-,69-63-,69-64- |
| InChIKey | FLOVQQCDLQZYRB-ONGUUPPPSA-N |
| XLogP | 20.93 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1110.65 |
| LogP ≤ 5 | 20.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|