C76H94N12O4 — CID 135542396
8-amino-N-[4-[10,15,20-tris[4-(8-aminooctanoylamino)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]octanamide (PubChem CID 135542396) has the molecular formula C76H94N12O4 and a molecular weight of 1239.67 g/mol. Its IUPAC name is 8-amino-N-[4-[10,15,20-tris[4-(8-aminooctanoylamino)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]octanamide.
| Compound Name | 8-amino-N-[4-[10,15,20-tris[4-(8-aminooctanoylamino)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]octanamide |
|---|---|
| PubChem CID | 135542396 |
| Molecular Formula | C76H94N12O4 |
| Molecular Weight | 1239.67 g/mol |
| Exact Mass | 1238.75 |
| IUPAC Name | 8-amino-N-[4-[10,15,20-tris[4-(8-aminooctanoylamino)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]octanamide |
| SMILES | NCCCCCCCC(=O)Nc1ccc(-c2c3nc(c(-c4ccc(NC(=O)CCCCCCCN)cc4)c4ccc([nH]4)c(-c4ccc(NC(=O)CCCCCCCN)cc4)c4nc(c(-c5ccc(NC(=O)CCCCCCCN)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C76H94N12O4/c77-49-17-9-1-5-13-21-69(89)81-57-33-25-53(26-34-57)73-61-41-43-63(85-61)74(54-27-35-58(36-28-54)82-70(90)22-14-6-2-10-18-50-78)65-45-47-67(87-65)76(56-31-39-60(40-32-56)84-72(92)24-16-8-4-12-20-52-80)68-48-46-66(88-68)75(64-44-42-62(73)86-64)55-29-37-59(38-30-55)83-71(91)23-15-7-3-11-19-51-79/h25-48,85,88H,1-24,49-52,77-80H2,(H,81,89)(H,82,90)(H,83,91)(H,84,92)/b73-61-,73-62-,74-63-,74-65-,75-64-,75-66-,76-67-,76-68- |
| InChIKey | ZJMFAFIXUMRMOX-IAPFGHMISA-N |
| XLogP | 16.27 |
| TPSA | 277.84 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1239.67 |
| LogP ≤ 5 | 16.27 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|