C48H36ClN5O — CID 10887120
4-chloro-N-[4-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)phenyl]butanamide (PubChem CID 10887120) has the molecular formula C48H36ClN5O and a molecular weight of 734.30 g/mol. Its IUPAC name is 4-chloro-N-[4-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)phenyl]butanamide.
| Compound Name | 4-chloro-N-[4-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 10887120 |
| Molecular Formula | C48H36ClN5O |
| Molecular Weight | 734.30 g/mol |
| Exact Mass | 733.26 |
| IUPAC Name | 4-chloro-N-[4-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)phenyl]butanamide |
| SMILES | O=C(CCCCl)Nc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H36ClN5O/c49-30-10-17-44(55)50-35-20-18-34(19-21-35)48-42-28-26-40(53-42)46(32-13-6-2-7-14-32)38-24-22-36(51-38)45(31-11-4-1-5-12-31)37-23-25-39(52-37)47(33-15-8-3-9-16-33)41-27-29-43(48)54-41/h1-9,11-16,18-29,51-52H,10,17,30H2,(H,50,55)/b45-36-,45-37-,46-38-,46-40-,47-39-,47-41-,48-42-,48-43- |
| InChIKey | RNUJZONUTFXUIX-BRNXAVTDSA-N |
| XLogP | 12.28 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.30 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|