C76H90N8O4 — CID 136810655
N-[4-[10,15,20-tris[4-(octanoylamino)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]octanamide (PubChem CID 136810655) has the molecular formula C76H90N8O4 and a molecular weight of 1179.61 g/mol. Its IUPAC name is N-[4-[10,15,20-tris[4-(octanoylamino)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]octanamide.
| Compound Name | N-[4-[10,15,20-tris[4-(octanoylamino)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]octanamide |
|---|---|
| PubChem CID | 136810655 |
| Molecular Formula | C76H90N8O4 |
| Molecular Weight | 1179.61 g/mol |
| Exact Mass | 1178.71 |
| IUPAC Name | N-[4-[10,15,20-tris[4-(octanoylamino)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(-c2c3nc(c(-c4ccc(NC(=O)CCCCCCC)cc4)c4ccc([nH]4)c(-c4ccc(NC(=O)CCCCCCC)cc4)c4nc(c(-c5ccc(NC(=O)CCCCCCC)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C76H90N8O4/c1-5-9-13-17-21-25-69(85)77-57-37-29-53(30-38-57)73-61-45-47-63(81-61)74(54-31-39-58(40-32-54)78-70(86)26-22-18-14-10-6-2)65-49-51-67(83-65)76(56-35-43-60(44-36-56)80-72(88)28-24-20-16-12-8-4)68-52-50-66(84-68)75(64-48-46-62(73)82-64)55-33-41-59(42-34-55)79-71(87)27-23-19-15-11-7-3/h29-52,81,84H,5-28H2,1-4H3,(H,77,85)(H,78,86)(H,79,87)(H,80,88)/b73-61-,73-62-,74-63-,74-65-,75-64-,75-66-,76-67-,76-68- |
| InChIKey | VMVLLRGKRSVNTD-IAPFGHMISA-N |
| XLogP | 20.52 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 88 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1179.61 |
| LogP ≤ 5 | 20.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|