C38H33N5O — CID 11467287
N-(10,20-diphenyl-23,24-dihydroporphyrin-5-yl)hexanamide (PubChem CID 11467287) has the molecular formula C38H33N5O and a molecular weight of 575.72 g/mol. Its IUPAC name is N-(10,20-diphenyl-23,24-dihydroporphyrin-5-yl)hexanamide.
| Compound Name | N-(10,20-diphenyl-23,24-dihydroporphyrin-5-yl)hexanamide |
|---|---|
| PubChem CID | 11467287 |
| Molecular Formula | C38H33N5O |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | N-(10,20-diphenyl-23,24-dihydroporphyrin-5-yl)hexanamide |
| SMILES | CCCCCC(=O)Nc1c2nc(c(-c3ccccc3)c3ccc(cc4ccc([nH]4)c(-c4ccccc4)c4nc1C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C38H33N5O/c1-2-3-6-15-35(44)43-38-33-22-20-31(41-33)36(25-11-7-4-8-12-25)29-18-16-27(39-29)24-28-17-19-30(40-28)37(26-13-9-5-10-14-26)32-21-23-34(38)42-32/h4-5,7-14,16-24,39-40H,2-3,6,15H2,1H3,(H,43,44)/b27-24-,28-24-,36-29-,36-31-,37-30-,37-32-,38-33+,38-34+ |
| InChIKey | RWTQYQJJUIMEMO-JBARNPONSA-N |
| XLogP | 9.51 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|