C44H38N4O — CID 136798654
3-(15-hexyl-10,20-diphenyl-21,23-dihydroporphyrin-5-yl)phenol (PubChem CID 136798654) has the molecular formula C44H38N4O and a molecular weight of 638.82 g/mol. Its IUPAC name is 3-(15-hexyl-10,20-diphenyl-21,23-dihydroporphyrin-5-yl)phenol.
| Compound Name | 3-(15-hexyl-10,20-diphenyl-21,23-dihydroporphyrin-5-yl)phenol |
|---|---|
| PubChem CID | 136798654 |
| Molecular Formula | C44H38N4O |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | 3-(15-hexyl-10,20-diphenyl-21,23-dihydroporphyrin-5-yl)phenol |
| SMILES | CCCCCCc1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3cccc(O)c3)c3nc(c(-c4ccccc4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C44H38N4O/c1-2-3-4-11-19-33-34-20-22-36(45-34)42(29-13-7-5-8-14-29)38-24-26-40(47-38)44(31-17-12-18-32(49)28-31)41-27-25-39(48-41)43(30-15-9-6-10-16-30)37-23-21-35(33)46-37/h5-10,12-18,20-28,45,48-49H,2-4,11,19H2,1H3/b34-33-,35-33-,42-36-,42-38-,43-37-,43-39-,44-40-,44-41- |
| InChIKey | CIQQFBCBQMFWDQ-UDYGMXFRSA-N |
| XLogP | 11.48 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|