C46H42N4 — CID 136754225
5,15-bis(4-ethynylphenyl)-10,20-dipentyl-21,22-dihydroporphyrin (PubChem CID 136754225) has the molecular formula C46H42N4 and a molecular weight of 650.87 g/mol. Its IUPAC name is 5,15-bis(4-ethynylphenyl)-10,20-dipentyl-21,22-dihydroporphyrin.
| Compound Name | 5,15-bis(4-ethynylphenyl)-10,20-dipentyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 136754225 |
| Molecular Formula | C46H42N4 |
| Molecular Weight | 650.87 g/mol |
| Exact Mass | 650.34 |
| IUPAC Name | 5,15-bis(4-ethynylphenyl)-10,20-dipentyl-21,22-dihydroporphyrin |
| SMILES | C#Cc1ccc(-c2c3nc(c(CCCCC)c4ccc([nH]4)c(-c4ccc(C#C)cc4)c4ccc([nH]4)c(CCCCC)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H42N4/c1-5-9-11-13-35-37-23-27-41(47-37)45(33-19-15-31(7-3)16-20-33)43-29-25-39(49-43)36(14-12-10-6-2)40-26-30-44(50-40)46(42-28-24-38(35)48-42)34-21-17-32(8-4)18-22-34/h3-4,15-30,47,49H,5-6,9-14H2,1-2H3/b37-35-,38-35-,39-36-,40-36-,45-41-,45-43-,46-42-,46-44- |
| InChIKey | WEHBFSTUBPENAQ-LOAXVJGISA-N |
| XLogP | 11.42 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.87 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|