C53H57N5O — CID 136701566
4-(N-[4-(10,15,20-tripentyl-21,23-dihydroporphyrin-5-yl)phenyl]anilino)phenol (PubChem CID 136701566) has the molecular formula C53H57N5O and a molecular weight of 780.07 g/mol. Its IUPAC name is 4-(N-[4-(10,15,20-tripentyl-21,23-dihydroporphyrin-5-yl)phenyl]anilino)phenol.
| Compound Name | 4-(N-[4-(10,15,20-tripentyl-21,23-dihydroporphyrin-5-yl)phenyl]anilino)phenol |
|---|---|
| PubChem CID | 136701566 |
| Molecular Formula | C53H57N5O |
| Molecular Weight | 780.07 g/mol |
| Exact Mass | 779.46 |
| IUPAC Name | 4-(N-[4-(10,15,20-tripentyl-21,23-dihydroporphyrin-5-yl)phenyl]anilino)phenol |
| SMILES | CCCCCc1c2nc(c(CCCCC)c3ccc([nH]3)c(-c3ccc(N(c4ccccc4)c4ccc(O)cc4)cc3)c3nc(c(CCCCC)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C53H57N5O/c1-4-7-11-18-42-45-29-31-47(54-45)43(19-12-8-5-2)49-33-35-51(56-49)53(52-36-34-50(57-52)44(20-13-9-6-3)48-32-30-46(42)55-48)37-21-23-39(24-22-37)58(38-16-14-10-15-17-38)40-25-27-41(59)28-26-40/h10,14-17,21-36,54,57,59H,4-9,11-13,18-20H2,1-3H3/b45-42-,46-42-,47-43-,48-44-,49-43-,50-44-,53-51-,53-52- |
| InChIKey | ZXISVDPQYBIUMY-RZWSKVFUSA-N |
| XLogP | 14.70 |
| TPSA | 80.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.07 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|