C46H50N4O6 — CID 143961271
4-[(12S,13R)-10-butyl-15-(4-carboxyphenyl)-20-hexyl-12,13-dihydroxy-12,13,22,24-tetrahydroporphyrin-5-yl]benzoic acid;ethane (PubChem CID 143961271) has the molecular formula C46H50N4O6 and a molecular weight of 754.93 g/mol. Its IUPAC name is 4-[(12S,13R)-10-butyl-15-(4-carboxyphenyl)-20-hexyl-12,13-dihydroxy-12,13,22,24-tetrahydroporphyrin-5-yl]benzoic acid;ethane.
| Compound Name | 4-[(12S,13R)-10-butyl-15-(4-carboxyphenyl)-20-hexyl-12,13-dihydroxy-12,13,22,24-tetrahydroporphyrin-5-yl]benzoic acid;ethane |
|---|---|
| PubChem CID | 143961271 |
| Molecular Formula | C46H50N4O6 |
| Molecular Weight | 754.93 g/mol |
| Exact Mass | 754.37 |
| IUPAC Name | 4-[(12S,13R)-10-butyl-15-(4-carboxyphenyl)-20-hexyl-12,13-dihydroxy-12,13,22,24-tetrahydroporphyrin-5-yl]benzoic acid;ethane |
| SMILES | CC.CCCCCCc1c2nc(c(-c3ccc(C(=O)O)cc3)c3ccc([nH]3)c(CCCC)c3nc(c(-c4ccc(C(=O)O)cc4)c4ccc1[nH]4)[C@@H](O)[C@H]3O)C=C2 |
| InChI | InChI=1S/C44H44N4O6.C2H6/c1-3-5-7-8-10-29-31-19-22-34(45-31)37(25-11-15-27(16-12-25)43(51)52)35-23-21-33(47-35)30(9-6-4-2)39-41(49)42(50)40(48-39)38(36-24-20-32(29)46-36)26-13-17-28(18-14-26)44(53)54;1-2/h11-24,41-42,46-47,49-50H,3-10H2,1-2H3,(H,51,52)(H,53,54);1-2H3/b31-29-,32-29-,33-30-,37-34-,37-35-,38-36-,39-30-,40-38-;/t41-,42+;/m0./s1 |
| InChIKey | IXPVGYMXWQZZQM-KKMILMJTSA-N |
| XLogP | 10.47 |
| TPSA | 172.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.93 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|