C48H32N4O7 — CID 146363651
4-[10,15-bis(4-carboxyphenyl)-20-[4-(hydroxymethyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 146363651) has the molecular formula C48H32N4O7 and a molecular weight of 776.81 g/mol. Its IUPAC name is 4-[10,15-bis(4-carboxyphenyl)-20-[4-(hydroxymethyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10,15-bis(4-carboxyphenyl)-20-[4-(hydroxymethyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 146363651 |
| Molecular Formula | C48H32N4O7 |
| Molecular Weight | 776.81 g/mol |
| Exact Mass | 776.23 |
| IUPAC Name | 4-[10,15-bis(4-carboxyphenyl)-20-[4-(hydroxymethyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)O)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)O)cc4)c4nc(c(-c5ccc(CO)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H32N4O7/c53-25-26-1-3-27(4-2-26)42-34-17-19-36(49-34)43(28-5-11-31(12-6-28)46(54)55)38-21-23-40(51-38)45(30-9-15-33(16-10-30)48(58)59)41-24-22-39(52-41)44(37-20-18-35(42)50-37)29-7-13-32(14-8-29)47(56)57/h1-24,49,52-53H,25H2,(H,54,55)(H,56,57)(H,58,59)/b42-34-,42-35-,43-36-,43-38-,44-37-,44-39-,45-40-,45-41- |
| InChIKey | GFRYFSQMWQHCGY-HIXPDHBDSA-N |
| XLogP | 9.91 |
| TPSA | 189.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.81 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |