C45H27N7O8 — CID 136829697
4-[10,15,20-tris(2-nitrophenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 136829697) has the molecular formula C45H27N7O8 and a molecular weight of 793.75 g/mol. Its IUPAC name is 4-[10,15,20-tris(2-nitrophenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10,15,20-tris(2-nitrophenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 136829697 |
| Molecular Formula | C45H27N7O8 |
| Molecular Weight | 793.75 g/mol |
| Exact Mass | 793.19 |
| IUPAC Name | 4-[10,15,20-tris(2-nitrophenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3nc(c(-c4ccccc4[N+](=O)[O-])c4ccc([nH]4)c(-c4ccccc4[N+](=O)[O-])c4nc(c(-c5ccccc5[N+](=O)[O-])c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C45H27N7O8/c53-45(54)26-15-13-25(14-16-26)41-30-17-19-32(46-30)42(27-7-1-4-10-38(27)50(55)56)34-21-23-36(48-34)44(29-9-3-6-12-40(29)52(59)60)37-24-22-35(49-37)43(33-20-18-31(41)47-33)28-8-2-5-11-39(28)51(57)58/h1-24,46,49H,(H,53,54)/b41-30-,41-31-,42-32-,42-34-,43-33-,43-35-,44-36-,44-37- |
| InChIKey | QSQIFUGKPGRXEQ-IJIGJLIQSA-N |
| XLogP | 10.75 |
| TPSA | 224.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.75 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|