C39H24N4O2S3 — CID 136868448
4-(10,15,20-trithiophen-2-yl-21,23-dihydroporphyrin-5-yl)benzoic acid (PubChem CID 136868448) has the molecular formula C39H24N4O2S3 and a molecular weight of 676.85 g/mol. Its IUPAC name is 4-(10,15,20-trithiophen-2-yl-21,23-dihydroporphyrin-5-yl)benzoic acid.
| Compound Name | 4-(10,15,20-trithiophen-2-yl-21,23-dihydroporphyrin-5-yl)benzoic acid |
|---|---|
| PubChem CID | 136868448 |
| Molecular Formula | C39H24N4O2S3 |
| Molecular Weight | 676.85 g/mol |
| Exact Mass | 676.11 |
| IUPAC Name | 4-(10,15,20-trithiophen-2-yl-21,23-dihydroporphyrin-5-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3nc(c(-c4cccs4)c4ccc([nH]4)c(-c4cccs4)c4nc(c(-c5cccs5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C39H24N4O2S3/c44-39(45)23-9-7-22(8-10-23)35-24-11-13-26(40-24)36(32-4-1-19-46-32)28-15-17-30(42-28)38(34-6-3-21-48-34)31-18-16-29(43-31)37(33-5-2-20-47-33)27-14-12-25(35)41-27/h1-21,40,43H,(H,44,45)/b35-24-,35-25-,36-26+,36-28+,37-27+,37-29+,38-30+,38-31+ |
| InChIKey | FOAYIUOXBUFLAS-XXUAURMFSA-N |
| XLogP | 11.21 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.85 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |