C38H25N5S3 — CID 135847921
4-(10,15,20-trithiophen-2-yl-21,23-dihydroporphyrin-5-yl)aniline (PubChem CID 135847921) has the molecular formula C38H25N5S3 and a molecular weight of 647.85 g/mol. Its IUPAC name is 4-(10,15,20-trithiophen-2-yl-21,23-dihydroporphyrin-5-yl)aniline.
| Compound Name | 4-(10,15,20-trithiophen-2-yl-21,23-dihydroporphyrin-5-yl)aniline |
|---|---|
| PubChem CID | 135847921 |
| Molecular Formula | C38H25N5S3 |
| Molecular Weight | 647.85 g/mol |
| Exact Mass | 647.13 |
| IUPAC Name | 4-(10,15,20-trithiophen-2-yl-21,23-dihydroporphyrin-5-yl)aniline |
| SMILES | Nc1ccc(-c2c3nc(c(-c4cccs4)c4ccc([nH]4)c(-c4cccs4)c4nc(c(-c5cccs5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C38H25N5S3/c39-23-9-7-22(8-10-23)35-24-11-13-26(40-24)36(32-4-1-19-44-32)28-15-17-30(42-28)38(34-6-3-21-46-34)31-18-16-29(43-31)37(33-5-2-20-45-33)27-14-12-25(35)41-27/h1-21,40,43H,39H2/b35-24-,35-25-,36-26+,36-28+,37-27+,37-29+,38-30+,38-31+ |
| InChIKey | ANOVTGUHBXPHFY-XXUAURMFSA-N |
| XLogP | 11.09 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.85 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|