C40H26N4S2 — CID 10371773
5,10-diphenyl-15,20-dithiophen-2-yl-21,22-dihydroporphyrin (PubChem CID 10371773) has the molecular formula C40H26N4S2 and a molecular weight of 626.81 g/mol. Its IUPAC name is 5,10-diphenyl-15,20-dithiophen-2-yl-21,22-dihydroporphyrin.
| Compound Name | 5,10-diphenyl-15,20-dithiophen-2-yl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10371773 |
| Molecular Formula | C40H26N4S2 |
| Molecular Weight | 626.81 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | 5,10-diphenyl-15,20-dithiophen-2-yl-21,22-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(-c1cccs1)c1nc(c(-c3cccs3)c3ccc([nH]3)c(-c3ccccc3)c3ccc([nH]3)c2-c2ccccc2)C=C1 |
| InChI | InChI=1S/C40H26N4S2/c1-3-9-25(10-4-1)37-27-15-16-28(41-27)38(26-11-5-2-6-12-26)30-18-20-32(43-30)40(36-14-8-24-46-36)34-22-21-33(44-34)39(35-13-7-23-45-35)31-19-17-29(37)42-31/h1-24,41-42H/b37-27-,37-29-,38-28-,38-30-,39-31+,39-33+,40-32+,40-34+ |
| InChIKey | IJONTNRUHBMWAZ-PSWHUVFFSA-N |
| XLogP | 11.45 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.81 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |