C58H38N4S3 — CID 23250040
7-[(E)-2-(2,5-dithiophen-2-ylthiophen-3-yl)ethenyl]-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin (PubChem CID 23250040) has the molecular formula C58H38N4S3 and a molecular weight of 887.17 g/mol. Its IUPAC name is 7-[(E)-2-(2,5-dithiophen-2-ylthiophen-3-yl)ethenyl]-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin.
| Compound Name | 7-[(E)-2-(2,5-dithiophen-2-ylthiophen-3-yl)ethenyl]-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 23250040 |
| Molecular Formula | C58H38N4S3 |
| Molecular Weight | 887.17 g/mol |
| Exact Mass | 886.23 |
| IUPAC Name | 7-[(E)-2-(2,5-dithiophen-2-ylthiophen-3-yl)ethenyl]-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c2-c2ccccc2)C(/C=C/c2cc(-c3cccs3)sc2-c2cccs2)=C1 |
| InChI | InChI=1S/C58H38N4S3/c1-5-15-37(16-6-1)53-43-27-28-44(59-43)54(38-17-7-2-8-18-38)46-31-32-48(61-46)56(40-21-11-4-12-22-40)57-41(35-49(62-57)55(39-19-9-3-10-20-39)47-30-29-45(53)60-47)25-26-42-36-52(50-23-13-33-63-50)65-58(42)51-24-14-34-64-51/h1-36,60-61H/b26-25+,53-43-,53-45-,54-44-,54-46-,55-47-,55-49-,56-48-,57-56- |
| InChIKey | AADNELGSHLAPCF-OIUUUOBTSA-N |
| XLogP | 16.93 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.17 |
| LogP ≤ 5 | 16.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |