C54H37ClN6O4 — CID 135450913
5,10,15,20-tetraphenyl-7-(4-pyridin-4-ylpyridin-1-ium-1-yl)-21,23-dihydroporphyrin perchlorate (PubChem CID 135450913) has the molecular formula C54H37ClN6O4 and a molecular weight of 869.38 g/mol. Its IUPAC name is 5,10,15,20-tetraphenyl-7-(4-pyridin-4-ylpyridin-1-ium-1-yl)-21,23-dihydroporphyrin perchlorate.
| Compound Name | 5,10,15,20-tetraphenyl-7-(4-pyridin-4-ylpyridin-1-ium-1-yl)-21,23-dihydroporphyrin perchlorate |
|---|---|
| PubChem CID | 135450913 |
| Molecular Formula | C54H37ClN6O4 |
| Molecular Weight | 869.38 g/mol |
| Exact Mass | 868.26 |
| IUPAC Name | 5,10,15,20-tetraphenyl-7-(4-pyridin-4-ylpyridin-1-ium-1-yl)-21,23-dihydroporphyrin perchlorate |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c2-c2ccccc2)C([n+]2ccc(-c3ccncc3)cc2)=C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C54H36N6.ClHO4/c1-5-13-38(14-6-1)50-42-21-22-43(56-42)51(39-15-7-2-8-16-39)45-25-26-47(58-45)53(41-19-11-4-12-20-41)54-49(60-33-29-37(30-34-60)36-27-31-55-32-28-36)35-48(59-54)52(40-17-9-3-10-18-40)46-24-23-44(50)57-46;2-1(3,4)5/h1-35,55H;(H,2,3,4,5)/b50-42-,50-44-,51-43-,51-45-,52-46-,52-48-,53-47-,54-53-; |
| InChIKey | HDOBVVGKDZTKNS-KKJLQOAESA-N |
| XLogP | 7.79 |
| TPSA | 166.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.38 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|