C50H34N4S — CID 135458064
5,10,15,20-tetraphenyl-2-[(E)-2-thiophen-3-ylethenyl]-21,23-dihydroporphyrin (PubChem CID 135458064) has the molecular formula C50H34N4S and a molecular weight of 722.92 g/mol. Its IUPAC name is 5,10,15,20-tetraphenyl-2-[(E)-2-thiophen-3-ylethenyl]-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetraphenyl-2-[(E)-2-thiophen-3-ylethenyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135458064 |
| Molecular Formula | C50H34N4S |
| Molecular Weight | 722.92 g/mol |
| Exact Mass | 722.25 |
| IUPAC Name | 5,10,15,20-tetraphenyl-2-[(E)-2-thiophen-3-ylethenyl]-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3[nH]c(cc3/C=C/c3ccsc3)c2-c2ccccc2)C=C1 |
| InChI | InChI=1S/C50H34N4S/c1-5-13-34(14-6-1)46-39-23-24-40(51-39)47(35-15-7-2-8-16-35)42-27-28-44(53-42)49(37-19-11-4-12-20-37)50-38(22-21-33-29-30-55-32-33)31-45(54-50)48(36-17-9-3-10-18-36)43-26-25-41(46)52-43/h1-32,51,54H/b22-21+,46-39-,46-41-,47-40-,47-42-,48-43-,48-45-,49-44-,50-49- |
| InChIKey | IDRMICLGYUOIIF-BPMSDLFHSA-N |
| XLogP | 13.56 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.92 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |