C46H31N5O2 — CID 137235484
2-(2-nitroethenyl)-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin (PubChem CID 137235484) has the molecular formula C46H31N5O2 and a molecular weight of 685.79 g/mol. Its IUPAC name is 2-(2-nitroethenyl)-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin.
| Compound Name | 2-(2-nitroethenyl)-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 137235484 |
| Molecular Formula | C46H31N5O2 |
| Molecular Weight | 685.79 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | 2-(2-nitroethenyl)-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
| SMILES | O=[N+]([O-])C=Cc1cc2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c2-c2ccccc2)C=C3)C=C1 |
| InChI | InChI=1S/C46H31N5O2/c52-51(53)28-27-34-29-41-44(32-17-9-3-10-18-32)39-24-23-37(48-39)42(30-13-5-1-6-14-30)35-21-22-36(47-35)43(31-15-7-2-8-16-31)38-25-26-40(49-38)45(46(34)50-41)33-19-11-4-12-20-33/h1-29,47,50H/b28-27?,42-35-,42-37-,43-36-,43-38-,44-39-,44-41-,45-40-,46-45- |
| InChIKey | FTCHTHGKFHOVCX-KTULWEGOSA-N |
| XLogP | 11.57 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.79 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|