C44H29N4Sn — CID 169095894
CID 169095894 (PubChem CID 169095894) has the molecular formula C44H29N4Sn and a molecular weight of 732.46 g/mol.
| Compound Name | CID 169095894 |
|---|---|
| PubChem CID | 169095894 |
| Molecular Formula | C44H29N4Sn |
| Molecular Weight | 732.46 g/mol |
| Exact Mass | 733.14 |
| IUPAC Name | — |
| SMILES | [Sn]c1cc2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c2-c2ccccc2)C=C3)C=C1 |
| InChI | InChI=1S/C44H29N4.Sn/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;/h1-27,45,48H;/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | BSKMLBAUUDIHIU-DAJBKUBHSA-N |
| XLogP | 10.12 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.46 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |