C45H28N4O — CID 136677028
14,19,24-triphenyl-12,28,29,30-tetrazaheptacyclo[23.2.1.110,13.115,18.120,23.02,11.03,8]hentriaconta-1,3,5,7,10,13(31),14,16,18(30),19,21,23,25(28),26-tetradecaen-9-one (PubChem CID 136677028) has the molecular formula C45H28N4O and a molecular weight of 640.75 g/mol. Its IUPAC name is 14,19,24-triphenyl-12,28,29,30-tetrazaheptacyclo[23.2.1.110,13.115,18.120,23.02,11.03,8]hentriaconta-1,3,5,7,10,13(31),14,16,18(30),19,21,23,25(28),26-tetradecaen-9-one.
| Compound Name | 14,19,24-triphenyl-12,28,29,30-tetrazaheptacyclo[23.2.1.110,13.115,18.120,23.02,11.03,8]hentriaconta-1,3,5,7,10,13(31),14,16,18(30),19,21,23,25(28),26-tetradecaen-9-one |
|---|---|
| PubChem CID | 136677028 |
| Molecular Formula | C45H28N4O |
| Molecular Weight | 640.75 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | 14,19,24-triphenyl-12,28,29,30-tetrazaheptacyclo[23.2.1.110,13.115,18.120,23.02,11.03,8]hentriaconta-1,3,5,7,10,13(31),14,16,18(30),19,21,23,25(28),26-tetradecaen-9-one |
| SMILES | O=C1c2ccccc2-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5cc1c2[nH]5)C=C4)C=C3 |
| InChI | InChI=1S/C45H28N4O/c50-45-31-19-11-10-18-30(31)43-38-25-24-36(48-38)41(28-14-6-2-7-15-28)34-21-20-33(46-34)40(27-12-4-1-5-13-27)35-22-23-37(47-35)42(29-16-8-3-9-17-29)39-26-32(45)44(43)49-39/h1-26,46,49H/b40-33-,40-35-,41-34-,41-36-,42-37-,42-39-,43-38- |
| InChIKey | AJESSILBQNPDMU-FJTIKLBISA-N |
| XLogP | 10.87 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.75 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |