C54H35N5O2 — CID 136819322
4-(3-amino-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin-2-yl)naphthalene-1,2-dione (PubChem CID 136819322) has the molecular formula C54H35N5O2 and a molecular weight of 785.91 g/mol. Its IUPAC name is 4-(3-amino-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin-2-yl)naphthalene-1,2-dione.
| Compound Name | 4-(3-amino-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin-2-yl)naphthalene-1,2-dione |
|---|---|
| PubChem CID | 136819322 |
| Molecular Formula | C54H35N5O2 |
| Molecular Weight | 785.91 g/mol |
| Exact Mass | 785.28 |
| IUPAC Name | 4-(3-amino-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin-2-yl)naphthalene-1,2-dione |
| SMILES | Nc1c(C2=CC(=O)C(=O)c3ccccc32)c2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c2-c2ccccc2)C=C3)C=C1 |
| InChI | InChI=1S/C54H35N5O2/c55-51-50(38-31-45(60)54(61)37-24-14-13-23-36(37)38)52-48(34-19-9-3-10-20-34)43-29-27-41(57-43)46(32-15-5-1-6-16-32)39-25-26-40(56-39)47(33-17-7-2-8-18-33)42-28-30-44(58-42)49(53(51)59-52)35-21-11-4-12-22-35/h1-31,56,59H,55H2/b46-39-,46-41-,47-40-,47-42-,48-43-,49-44-,52-48-,53-49- |
| InChIKey | JMXCFTIXWNPNLR-YBIBVMECSA-N |
| XLogP | 12.10 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.91 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|