C44H29N6+ — CID 135453726
2-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzenediazonium (PubChem CID 135453726) has the molecular formula C44H29N6+ and a molecular weight of 641.76 g/mol. Its IUPAC name is 2-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzenediazonium.
| Compound Name | 2-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzenediazonium |
|---|---|
| PubChem CID | 135453726 |
| Molecular Formula | C44H29N6+ |
| Molecular Weight | 641.76 g/mol |
| Exact Mass | 641.24 |
| IUPAC Name | 2-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzenediazonium |
| SMILES | N#[N+]c1ccccc1-c1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C44H28N6/c45-50-32-19-11-10-18-31(32)44-39-26-24-37(48-39)42(29-14-6-2-7-15-29)35-22-20-33(46-35)41(28-12-4-1-5-13-28)34-21-23-36(47-34)43(30-16-8-3-9-17-30)38-25-27-40(44)49-38/h1-27,45H/p+1/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | XFVWMGHRDCXSQA-LWQDQPMZSA-O |
| XLogP | 11.81 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.76 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|